C9H4F2N4OS — CID 22955921
2,5-difluoro-4-(3-oxo-5-sulfanylidene-1,2,4-triazolidin-4-yl)benzonitrile (PubChem CID 22955921) has the molecular formula C9H4F2N4OS and a molecular weight of 254.22 g/mol. Its IUPAC name is 2,5-difluoro-4-(3-oxo-5-sulfanylidene-1,2,4-triazolidin-4-yl)benzonitrile.
| Compound Name | 2,5-difluoro-4-(3-oxo-5-sulfanylidene-1,2,4-triazolidin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 22955921 |
| Molecular Formula | C9H4F2N4OS |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 2,5-difluoro-4-(3-oxo-5-sulfanylidene-1,2,4-triazolidin-4-yl)benzonitrile |
| SMILES | N#Cc1cc(F)c(-n2c(=O)[nH][nH]c2=S)cc1F |
| InChI | InChI=1S/C9H4F2N4OS/c10-5-2-7(6(11)1-4(5)3-12)15-8(16)13-14-9(15)17/h1-2H,(H,13,16)(H,14,17) |
| InChIKey | JYCHNAXEXCGRTR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|