C21H20N2O4 — CID 4306547
7-methoxy-4-(morpholin-4-ylmethylidene)-2-phenylisoquinoline-1,3-dione (PubChem CID 4306547) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 7-methoxy-4-(morpholin-4-ylmethylidene)-2-phenylisoquinoline-1,3-dione.
| Compound Name | 7-methoxy-4-(morpholin-4-ylmethylidene)-2-phenylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 4306547 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 7-methoxy-4-(morpholin-4-ylmethylidene)-2-phenylisoquinoline-1,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(c1ccccc1)C(=O)C2=CN1CCOCC1 |
| InChI | InChI=1S/C21H20N2O4/c1-26-16-7-8-17-18(13-16)20(24)23(15-5-3-2-4-6-15)21(25)19(17)14-22-9-11-27-12-10-22/h2-8,13-14H,9-12H2,1H3 |
| InChIKey | MNNXVXMQSFWLCZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|