C22H22N2O5 — CID 110565222
3-(2-methoxyphenyl)-1-(3-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 110565222) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-(3-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 3-(2-methoxyphenyl)-1-(3-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110565222 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-(3-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | COc1cccc(N2C(=O)C(c3ccccc3OC)=C(N3CCOCC3)C2=O)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-27-16-7-5-6-15(14-16)24-21(25)19(17-8-3-4-9-18(17)28-2)20(22(24)26)23-10-12-29-13-11-23/h3-9,14H,10-13H2,1-2H3 |
| InChIKey | VXQYIOGIAFUVLT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|