C19H24N2O4 — CID 110565797
1-butyl-3-(2-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione (PubChem CID 110565797) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is 1-butyl-3-(2-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione.
| Compound Name | 1-butyl-3-(2-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110565797 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-butyl-3-(2-methoxyphenyl)-4-morpholin-4-ylpyrrole-2,5-dione |
| SMILES | CCCCN1C(=O)C(c2ccccc2OC)=C(N2CCOCC2)C1=O |
| InChI | InChI=1S/C19H24N2O4/c1-3-4-9-21-18(22)16(14-7-5-6-8-15(14)24-2)17(19(21)23)20-10-12-25-13-11-20/h5-8H,3-4,9-13H2,1-2H3 |
| InChIKey | KFUCYTKGVZGHEC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|