C21H20N2O3 — CID 3003591
(3Z)-3-(morpholin-4-ylmethylidene)-1,5-diphenylpyrrolidine-2,4-dione (PubChem CID 3003591) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3Z)-3-(morpholin-4-ylmethylidene)-1,5-diphenylpyrrolidine-2,4-dione.
| Compound Name | (3Z)-3-(morpholin-4-ylmethylidene)-1,5-diphenylpyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 3003591 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (3Z)-3-(morpholin-4-ylmethylidene)-1,5-diphenylpyrrolidine-2,4-dione |
| SMILES | O=C1/C(=C/N2CCOCC2)C(=O)N(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c24-20-18(15-22-11-13-26-14-12-22)21(25)23(17-9-5-2-6-10-17)19(20)16-7-3-1-4-8-16/h1-10,15,19H,11-14H2/b18-15- |
| InChIKey | RGUYNKZWPSXBTA-SDXDJHTJSA-N |
| XLogP | 2.56 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|