C19H20N2O2S — CID 10337318
3-(4-morpholin-4-ylphenyl)-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 10337318) has the molecular formula C19H20N2O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-(4-morpholin-4-ylphenyl)-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-morpholin-4-ylphenyl)-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10337318 |
| Molecular Formula | C19H20N2O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 3-(4-morpholin-4-ylphenyl)-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccccc2)N1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20N2O2S/c22-18-14-24-19(15-4-2-1-3-5-15)21(18)17-8-6-16(7-9-17)20-10-12-23-13-11-20/h1-9,19H,10-14H2 |
| InChIKey | AQOLEDGPEVKAAY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|