C19H27N3O2S — CID 23818738
3-(2-morpholin-4-ylethyl)-2-(4-pyrrolidin-1-ylphenyl)-1,3-thiazolidin-4-one (PubChem CID 23818738) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethyl)-2-(4-pyrrolidin-1-ylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-morpholin-4-ylethyl)-2-(4-pyrrolidin-1-ylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23818738 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-(2-morpholin-4-ylethyl)-2-(4-pyrrolidin-1-ylphenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(N3CCCC3)cc2)N1CCN1CCOCC1 |
| InChI | InChI=1S/C19H27N3O2S/c23-18-15-25-19(22(18)10-9-20-11-13-24-14-12-20)16-3-5-17(6-4-16)21-7-1-2-8-21/h3-6,19H,1-2,7-15H2 |
| InChIKey | JBTGTQYKQFTQGP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|