C16H22N2OS — CID 3995232
2-phenyl-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 3995232) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-phenyl-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-phenyl-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3995232 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-phenyl-3-(2-piperidin-1-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccccc2)N1CCN1CCCCC1 |
| InChI | InChI=1S/C16H22N2OS/c19-15-13-20-16(14-7-3-1-4-8-14)18(15)12-11-17-9-5-2-6-10-17/h1,3-4,7-8,16H,2,5-6,9-13H2 |
| InChIKey | DGFFZZLVGJPRCR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |