C13H17NO2S — CID 3863407
3-(2-ethoxyethyl)-2-phenyl-1,3-thiazolidin-4-one (PubChem CID 3863407) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-2-phenyl-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethoxyethyl)-2-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3863407 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-(2-ethoxyethyl)-2-phenyl-1,3-thiazolidin-4-one |
| SMILES | CCOCCN1C(=O)CSC1c1ccccc1 |
| InChI | InChI=1S/C13H17NO2S/c1-2-16-9-8-14-12(15)10-17-13(14)11-6-4-3-5-7-11/h3-7,13H,2,8-10H2,1H3 |
| InChIKey | QIIJZEATDJBKMM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|