C16H23NO5S — CID 3846130
3-(2-ethoxyethyl)-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3846130) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-(2-ethoxyethyl)-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethoxyethyl)-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3846130 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-(2-ethoxyethyl)-2-(2,4,6-trimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCOCCN1C(=O)CSC1c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C16H23NO5S/c1-5-22-7-6-17-14(18)10-23-16(17)15-12(20-3)8-11(19-2)9-13(15)21-4/h8-9,16H,5-7,10H2,1-4H3 |
| InChIKey | HITMVDBVXXLGCB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|