C15H21NO4S — CID 3855111
2-(2,6-dimethoxyphenyl)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one (PubChem CID 3855111) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenyl)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,6-dimethoxyphenyl)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3855111 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(2,6-dimethoxyphenyl)-3-(3-methoxypropyl)-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)CSC1c1c(OC)cccc1OC |
| InChI | InChI=1S/C15H21NO4S/c1-18-9-5-8-16-13(17)10-21-15(16)14-11(19-2)6-4-7-12(14)20-3/h4,6-7,15H,5,8-10H2,1-3H3 |
| InChIKey | VKUAAFKHQMTMRY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|