C17H25NO3S — CID 3792966
3-(3-butoxypropyl)-2-(3-methoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3792966) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is 3-(3-butoxypropyl)-2-(3-methoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-butoxypropyl)-2-(3-methoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3792966 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-(3-butoxypropyl)-2-(3-methoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCCCOCCCN1C(=O)CSC1c1cccc(OC)c1 |
| InChI | InChI=1S/C17H25NO3S/c1-3-4-10-21-11-6-9-18-16(19)13-22-17(18)14-7-5-8-15(12-14)20-2/h5,7-8,12,17H,3-4,6,9-11,13H2,1-2H3 |
| InChIKey | YBNOEKYOBJSBFV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|