C18H27NO5S — CID 3852808
3-(3-propoxypropyl)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3852808) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is 3-(3-propoxypropyl)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-propoxypropyl)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3852808 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-(3-propoxypropyl)-2-(3,4,5-trimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCCOCCCN1C(=O)CSC1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H27NO5S/c1-5-8-24-9-6-7-19-16(20)12-25-18(19)13-10-14(21-2)17(23-4)15(11-13)22-3/h10-11,18H,5-9,12H2,1-4H3 |
| InChIKey | KNHWSWZFCMRNOP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|