C16H23NO4S — CID 3388078
2-(2,3-dimethoxyphenyl)-3-(3-ethoxypropyl)-1,3-thiazolidin-4-one (PubChem CID 3388078) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-3-(3-ethoxypropyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(2,3-dimethoxyphenyl)-3-(3-ethoxypropyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3388078 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-3-(3-ethoxypropyl)-1,3-thiazolidin-4-one |
| SMILES | CCOCCCN1C(=O)CSC1c1cccc(OC)c1OC |
| InChI | InChI=1S/C16H23NO4S/c1-4-21-10-6-9-17-14(18)11-22-16(17)12-7-5-8-13(19-2)15(12)20-3/h5,7-8,16H,4,6,9-11H2,1-3H3 |
| InChIKey | BVZLUOTUDWMPIM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|