C16H23NO4S2 — CID 3872207
3-(2-ethylsulfanylethyl)-2-(2,3,4-trimethoxyphenyl)-1,3-thiazolidin-4-one (PubChem CID 3872207) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-2-(2,3,4-trimethoxyphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-ethylsulfanylethyl)-2-(2,3,4-trimethoxyphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3872207 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-2-(2,3,4-trimethoxyphenyl)-1,3-thiazolidin-4-one |
| SMILES | CCSCCN1C(=O)CSC1c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C16H23NO4S2/c1-5-22-9-8-17-13(18)10-23-16(17)11-6-7-12(19-2)15(21-4)14(11)20-3/h6-7,16H,5,8-10H2,1-4H3 |
| InChIKey | NXNDHNGTHKASAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|