C17H20N2O3S2 — CID 3869284
methyl 3-[3-(2-ethylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-yl]-1H-indole-6-carboxylate (PubChem CID 3869284) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is methyl 3-[3-(2-ethylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-yl]-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[3-(2-ethylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 3869284 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | methyl 3-[3-(2-ethylsulfanylethyl)-4-oxo-1,3-thiazolidin-2-yl]-1H-indole-6-carboxylate |
| SMILES | CCSCCN1C(=O)CSC1c1c[nH]c2cc(C(=O)OC)ccc12 |
| InChI | InChI=1S/C17H20N2O3S2/c1-3-23-7-6-19-15(20)10-24-16(19)13-9-18-14-8-11(17(21)22-2)4-5-12(13)14/h4-5,8-9,16,18H,3,6-7,10H2,1-2H3 |
| InChIKey | BUYQPSQBVJAQLQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|