C21H22N2O4S2 — CID 3700944
methyl 3-[3-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-oxo-1,3-thiazinan-2-yl]-1H-indole-6-carboxylate (PubChem CID 3700944) has the molecular formula C21H22N2O4S2 and a molecular weight of 430.55 g/mol. Its IUPAC name is methyl 3-[3-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-oxo-1,3-thiazinan-2-yl]-1H-indole-6-carboxylate.
| Compound Name | methyl 3-[3-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-oxo-1,3-thiazinan-2-yl]-1H-indole-6-carboxylate |
|---|---|
| PubChem CID | 3700944 |
| Molecular Formula | C21H22N2O4S2 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | methyl 3-[3-[2-(furan-2-ylmethylsulfanyl)ethyl]-4-oxo-1,3-thiazinan-2-yl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3SCCC(=O)N3CCSCc3ccco3)c[nH]c2c1 |
| InChI | InChI=1S/C21H22N2O4S2/c1-26-21(25)14-4-5-16-17(12-22-18(16)11-14)20-23(19(24)6-9-29-20)7-10-28-13-15-3-2-8-27-15/h2-5,8,11-12,20,22H,6-7,9-10,13H2,1H3 |
| InChIKey | VSZKVGLACATZJQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|