C19H23NO5S2 — CID 3717202
3-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazinan-4-one (PubChem CID 3717202) has the molecular formula C19H23NO5S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazinan-4-one.
| Compound Name | 3-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3717202 |
| Molecular Formula | C19H23NO5S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3-[2-(furan-2-ylmethylsulfanyl)ethyl]-2-(4-hydroxy-3,5-dimethoxyphenyl)-1,3-thiazinan-4-one |
| SMILES | COc1cc(C2SCCC(=O)N2CCSCc2ccco2)cc(OC)c1O |
| InChI | InChI=1S/C19H23NO5S2/c1-23-15-10-13(11-16(24-2)18(15)22)19-20(17(21)5-8-27-19)6-9-26-12-14-4-3-7-25-14/h3-4,7,10-11,19,22H,5-6,8-9,12H2,1-2H3 |
| InChIKey | YNSUWVGSABSFJR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|