C19H19NO3S2 — CID 3537745
2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazinan-4-one (PubChem CID 3537745) has the molecular formula C19H19NO3S2 and a molecular weight of 373.50 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazinan-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3537745 |
| Molecular Formula | C19H19NO3S2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazinan-4-one |
| SMILES | O=C1CCSC(c2cc3ccccc3o2)N1CCSCc1ccco1 |
| InChI | InChI=1S/C19H19NO3S2/c21-18-7-10-25-19(17-12-14-4-1-2-6-16(14)23-17)20(18)8-11-24-13-15-5-3-9-22-15/h1-6,9,12,19H,7-8,10-11,13H2 |
| InChIKey | SMHHPJUYWKWLEN-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|