C16H19NO2S — CID 3281882
2-(1-benzofuran-2-yl)-3-(2-methylpropyl)-1,3-thiazinan-4-one (PubChem CID 3281882) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-(2-methylpropyl)-1,3-thiazinan-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-(2-methylpropyl)-1,3-thiazinan-4-one |
|---|---|
| PubChem CID | 3281882 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-(2-methylpropyl)-1,3-thiazinan-4-one |
| SMILES | CC(C)CN1C(=O)CCSC1c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H19NO2S/c1-11(2)10-17-15(18)7-8-20-16(17)14-9-12-5-3-4-6-13(12)19-14/h3-6,9,11,16H,7-8,10H2,1-2H3 |
| InChIKey | AOLUJMJLCLWQGY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |