C18H17NO3S2 — CID 3702133
2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one (PubChem CID 3702133) has the molecular formula C18H17NO3S2 and a molecular weight of 359.47 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3702133 |
| Molecular Formula | C18H17NO3S2 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cc3ccccc3o2)N1CCSCc1ccco1 |
| InChI | InChI=1S/C18H17NO3S2/c20-17-12-24-18(16-10-13-4-1-2-6-15(13)22-16)19(17)7-9-23-11-14-5-3-8-21-14/h1-6,8,10,18H,7,9,11-12H2 |
| InChIKey | AMOVHLHRACJUFZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|