C9H11NO2S — CID 3800198
3-ethyl-2-(furan-2-yl)-1,3-thiazolidin-4-one (PubChem CID 3800198) has the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-ethyl-2-(furan-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 3-ethyl-2-(furan-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3800198 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 3-ethyl-2-(furan-2-yl)-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1c1ccco1 |
| InChI | InChI=1S/C9H11NO2S/c1-2-10-8(11)6-13-9(10)7-4-3-5-12-7/h3-5,9H,2,6H2,1H3 |
| InChIKey | FVOYBFFCWXJKEC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |