C15H15ClN2OS — CID 132650324
2-[1-(2-chlorophenyl)pyrrol-3-yl]-3-ethyl-1,3-thiazolidin-4-one (PubChem CID 132650324) has the molecular formula C15H15ClN2OS and a molecular weight of 306.82 g/mol. Its IUPAC name is 2-[1-(2-chlorophenyl)pyrrol-3-yl]-3-ethyl-1,3-thiazolidin-4-one.
| Compound Name | 2-[1-(2-chlorophenyl)pyrrol-3-yl]-3-ethyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 132650324 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-[1-(2-chlorophenyl)pyrrol-3-yl]-3-ethyl-1,3-thiazolidin-4-one |
| SMILES | CCN1C(=O)CSC1c1ccn(-c2ccccc2Cl)c1 |
| InChI | InChI=1S/C15H15ClN2OS/c1-2-18-14(19)10-20-15(18)11-7-8-17(9-11)13-6-4-3-5-12(13)16/h3-9,15H,2,10H2,1H3 |
| InChIKey | HSQVINMZGROUBE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |