C21H20N2OS — CID 99964262
(2R)-3-benzyl-2-[1-(2-methylphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one (PubChem CID 99964262) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is (2R)-3-benzyl-2-[1-(2-methylphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one.
| Compound Name | (2R)-3-benzyl-2-[1-(2-methylphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 99964262 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2R)-3-benzyl-2-[1-(2-methylphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1-n1ccc([C@H]2SCC(=O)N2Cc2ccccc2)c1 |
| InChI | InChI=1S/C21H20N2OS/c1-16-7-5-6-10-19(16)22-12-11-18(14-22)21-23(20(24)15-25-21)13-17-8-3-2-4-9-17/h2-12,14,21H,13,15H2,1H3/t21-/m1/s1 |
| InChIKey | SPZBFAXASQCIJS-OAQYLSRUSA-N |
| XLogP | 4.56 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |