C22H22N2O2S — CID 99964306
(2S)-3-benzyl-2-[1-(2-ethoxyphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one (PubChem CID 99964306) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is (2S)-3-benzyl-2-[1-(2-ethoxyphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one.
| Compound Name | (2S)-3-benzyl-2-[1-(2-ethoxyphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 99964306 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2S)-3-benzyl-2-[1-(2-ethoxyphenyl)pyrrol-3-yl]-1,3-thiazolidin-4-one |
| SMILES | CCOc1ccccc1-n1ccc([C@@H]2SCC(=O)N2Cc2ccccc2)c1 |
| InChI | InChI=1S/C22H22N2O2S/c1-2-26-20-11-7-6-10-19(20)23-13-12-18(15-23)22-24(21(25)16-27-22)14-17-8-4-3-5-9-17/h3-13,15,22H,2,14,16H2,1H3/t22-/m0/s1 |
| InChIKey | MNSDKCHNFCSDFH-QFIPXVFZSA-N |
| XLogP | 4.65 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |