C20H25NO10S — CID 44613600
[(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-[[(2S)-2-(furan-2-yl)-4-oxo-1,3-thiazolidin-3-yl]methyl]-6-methoxyoxan-3-yl] acetate (PubChem CID 44613600) has the molecular formula C20H25NO10S and a molecular weight of 471.48 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-[[(2S)-2-(furan-2-yl)-4-oxo-1,3-thiazolidin-3-yl]methyl]-6-methoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-[[(2S)-2-(furan-2-yl)-4-oxo-1,3-thiazolidin-3-yl]methyl]-6-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 44613600 |
| Molecular Formula | C20H25NO10S |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-4,5-diacetyloxy-2-[[(2S)-2-(furan-2-yl)-4-oxo-1,3-thiazolidin-3-yl]methyl]-6-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@H]1O[C@H](CN2C(=O)CS[C@H]2c2ccco2)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO10S/c1-10(22)28-16-14(8-21-15(25)9-32-19(21)13-6-5-7-27-13)31-20(26-4)18(30-12(3)24)17(16)29-11(2)23/h5-7,14,16-20H,8-9H2,1-4H3/t14-,16-,17+,18-,19+,20+/m1/s1 |
| InChIKey | RSRYYBPZEWHZLS-AZQPHWPRSA-N |
| XLogP | 1.02 |
| TPSA | 130.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|