C10H13NO2S2 — CID 91576814
3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one (PubChem CID 91576814) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 91576814 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 3-[2-(furan-2-ylmethylsulfanyl)ethyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSCN1CCSCc1ccco1 |
| InChI | InChI=1S/C10H13NO2S2/c12-10-7-15-8-11(10)3-5-14-6-9-2-1-4-13-9/h1-2,4H,3,5-8H2 |
| InChIKey | VXHWVTOAAIXJPG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|