C11H11NOS — CID 63898466
2-(1-benzofuran-2-yl)-1,3-thiazolidine (PubChem CID 63898466) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-1,3-thiazolidine.
| Compound Name | 2-(1-benzofuran-2-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 63898466 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-1,3-thiazolidine |
| SMILES | c1ccc2oc(C3NCCS3)cc2c1 |
| InChI | InChI=1S/C11H11NOS/c1-2-4-9-8(3-1)7-10(13-9)11-12-5-6-14-11/h1-4,7,11-12H,5-6H2 |
| InChIKey | BXNZFSFVLXNVRZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |