C13H15NOS — CID 66216793
3-(1-benzofuran-2-yl)-1,4-thiazepane (PubChem CID 66216793) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is 3-(1-benzofuran-2-yl)-1,4-thiazepane.
| Compound Name | 3-(1-benzofuran-2-yl)-1,4-thiazepane |
|---|---|
| PubChem CID | 66216793 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-(1-benzofuran-2-yl)-1,4-thiazepane |
| SMILES | c1ccc2oc(C3CSCCCN3)cc2c1 |
| InChI | InChI=1S/C13H15NOS/c1-2-5-12-10(4-1)8-13(15-12)11-9-16-7-3-6-14-11/h1-2,4-5,8,11,14H,3,6-7,9H2 |
| InChIKey | GGEZEICUQBSYMI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |