About 3-(2-chlorophenyl)-1,4-thiazepane
3-(2-chlorophenyl)-1,4-thiazepane (PubChem CID 66217043) has the molecular formula C11H14ClNS
and a molecular weight of 227.76 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 3-(2-chlorophenyl)-1,4-thiazepane |
| PubChem CID | 66217043 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-(2-chlorophenyl)-1,4-thiazepane |
| SMILES | Clc1ccccc1C1CSCCCN1 |
| InChI | InChI=1S/C11H14ClNS/c12-10-5-2-1-4-9(10)11-8-14-7-3-6-13-11/h1-2,4-5,11,13H,3,6-8H2 |
| InChIKey | MQGCNGXUCRQLSK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-chlorophenyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chlorophenyl)-1,4-thiazepane?
The IUPAC name of 3-(2-chlorophenyl)-1,4-thiazepane (CID 66217043) is 3-(2-chlorophenyl)-1,4-thiazepane.
What is the SMILES notation for 3-(2-chlorophenyl)-1,4-thiazepane?
The canonical SMILES for 3-(2-chlorophenyl)-1,4-thiazepane is Clc1ccccc1C1CSCCCN1.
What is the InChIKey of 3-(2-chlorophenyl)-1,4-thiazepane?
The InChIKey is MQGCNGXUCRQLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClNS/c12-10-5-2-1-4-9(10)11-8-14-7-3-6-13-11/h1-2,4-5,11,13H,3,6-8H2.
What are the key properties of 3-(2-chlorophenyl)-1,4-thiazepane?
3-(2-chlorophenyl)-1,4-thiazepane has a molecular weight of 227.76 g/mol, XLogP of 3.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chlorophenyl)-1,4-thiazepane is sourced from PubChem (CID 66217043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).