C11H14ClNS — CID 66217043
3-(2-chlorophenyl)-1,4-thiazepane (PubChem CID 66217043) has the molecular formula C11H14ClNS and a molecular weight of 227.76 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,4-thiazepane.
| Compound Name | 3-(2-chlorophenyl)-1,4-thiazepane |
|---|---|
| PubChem CID | 66217043 |
| Molecular Formula | C11H14ClNS |
| Molecular Weight | 227.76 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 3-(2-chlorophenyl)-1,4-thiazepane |
| SMILES | Clc1ccccc1C1CSCCCN1 |
| InChI | InChI=1S/C11H14ClNS/c12-10-5-2-1-4-9(10)11-8-14-7-3-6-13-11/h1-2,4-5,11,13H,3,6-8H2 |
| InChIKey | MQGCNGXUCRQLSK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.76 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |