C11H14ClNO2S — CID 66217551
3-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide (PubChem CID 66217551) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide.
| Compound Name | 3-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 66217551 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-(2-chlorophenyl)-1,4-thiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCCNC(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C11H14ClNO2S/c12-10-5-2-1-4-9(10)11-8-16(14,15)7-3-6-13-11/h1-2,4-5,11,13H,3,6-8H2 |
| InChIKey | FEQRFOHRHCZHDR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |