C12H17NO3S — CID 66217554
3-(2-methoxyphenyl)-1,4-thiazepane 1,1-dioxide (PubChem CID 66217554) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1,4-thiazepane 1,1-dioxide.
| Compound Name | 3-(2-methoxyphenyl)-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 66217554 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-(2-methoxyphenyl)-1,4-thiazepane 1,1-dioxide |
| SMILES | COc1ccccc1C1CS(=O)(=O)CCCN1 |
| InChI | InChI=1S/C12H17NO3S/c1-16-12-6-3-2-5-10(12)11-9-17(14,15)8-4-7-13-11/h2-3,5-6,11,13H,4,7-9H2,1H3 |
| InChIKey | QZWMGOGDQCTAIY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |