C13H20N2O — CID 82286361
5-(2-methoxyphenyl)-1-methyl-1,4-diazepane (PubChem CID 82286361) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-1-methyl-1,4-diazepane.
| Compound Name | 5-(2-methoxyphenyl)-1-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 82286361 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 5-(2-methoxyphenyl)-1-methyl-1,4-diazepane |
| SMILES | COc1ccccc1C1CCN(C)CCN1 |
| InChI | InChI=1S/C13H20N2O/c1-15-9-7-12(14-8-10-15)11-5-3-4-6-13(11)16-2/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | KDVLWQIMMUSSDF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |