C26H40N4O2 — CID 102149859
5,12-bis(2-methoxyphenyl)-7,14-dimethyl-1,4,8,11-tetrazacyclotetradecane (PubChem CID 102149859) has the molecular formula C26H40N4O2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 5,12-bis(2-methoxyphenyl)-7,14-dimethyl-1,4,8,11-tetrazacyclotetradecane.
| Compound Name | 5,12-bis(2-methoxyphenyl)-7,14-dimethyl-1,4,8,11-tetrazacyclotetradecane |
|---|---|
| PubChem CID | 102149859 |
| Molecular Formula | C26H40N4O2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.32 |
| IUPAC Name | 5,12-bis(2-methoxyphenyl)-7,14-dimethyl-1,4,8,11-tetrazacyclotetradecane |
| SMILES | COc1ccccc1C1CC(C)NCCNC(c2ccccc2OC)CC(C)NCCN1 |
| InChI | InChI=1S/C26H40N4O2/c1-19-17-23(21-9-5-7-11-25(21)31-3)29-16-14-28-20(2)18-24(30-15-13-27-19)22-10-6-8-12-26(22)32-4/h5-12,19-20,23-24,27-30H,13-18H2,1-4H3 |
| InChIKey | QKFQBNFRDRMBJS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |