C11H15NOS — CID 66219247
2-(2-methoxyphenyl)-1,3-thiazinane (PubChem CID 66219247) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,3-thiazinane.
| Compound Name | 2-(2-methoxyphenyl)-1,3-thiazinane |
|---|---|
| PubChem CID | 66219247 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,3-thiazinane |
| SMILES | COc1ccccc1C1NCCCS1 |
| InChI | InChI=1S/C11H15NOS/c1-13-10-6-3-2-5-9(10)11-12-7-4-8-14-11/h2-3,5-6,11-12H,4,7-8H2,1H3 |
| InChIKey | CQFNYSKFJWKPNH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |