C11H14ClNOS — CID 66217529
2-(3-chloro-4-methoxyphenyl)-1,3-thiazinane (PubChem CID 66217529) has the molecular formula C11H14ClNOS and a molecular weight of 243.76 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-1,3-thiazinane.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-1,3-thiazinane |
|---|---|
| PubChem CID | 66217529 |
| Molecular Formula | C11H14ClNOS |
| Molecular Weight | 243.76 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-1,3-thiazinane |
| SMILES | COc1ccc(C2NCCCS2)cc1Cl |
| InChI | InChI=1S/C11H14ClNOS/c1-14-10-4-3-8(7-9(10)12)11-13-5-2-6-15-11/h3-4,7,11,13H,2,5-6H2,1H3 |
| InChIKey | BUSCUOFNPPJOGM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.76 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |