C10H13BrClNOS — CID 126475922
2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine;hydrochloride (PubChem CID 126475922) has the molecular formula C10H13BrClNOS and a molecular weight of 310.64 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine;hydrochloride.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine;hydrochloride |
|---|---|
| PubChem CID | 126475922 |
| Molecular Formula | C10H13BrClNOS |
| Molecular Weight | 310.64 g/mol |
| Exact Mass | 308.96 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidine;hydrochloride |
| SMILES | COc1ccc(C2NCCS2)cc1Br.Cl |
| InChI | InChI=1S/C10H12BrNOS.ClH/c1-13-9-3-2-7(6-8(9)11)10-12-4-5-14-10;/h2-3,6,10,12H,4-5H2,1H3;1H |
| InChIKey | CCVYQCCCLHSEQP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.64 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |