C9H12N2OS — CID 114938310
2-(6-methoxy-3-pyridinyl)-1,3-thiazolidine (PubChem CID 114938310) has the molecular formula C9H12N2OS and a molecular weight of 196.28 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-1,3-thiazolidine.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 114938310 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-1,3-thiazolidine |
| SMILES | COc1ccc(C2NCCS2)cn1 |
| InChI | InChI=1S/C9H12N2OS/c1-12-8-3-2-7(6-11-8)9-10-4-5-13-9/h2-3,6,9-10H,4-5H2,1H3 |
| InChIKey | BGDBDTSMRHGYCC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |