C9H10FNS — CID 42544128
(2R)-2-(4-fluorophenyl)-1,3-thiazolidine (PubChem CID 42544128) has the molecular formula C9H10FNS and a molecular weight of 183.25 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-1,3-thiazolidine.
| Compound Name | (2R)-2-(4-fluorophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 42544128 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-1,3-thiazolidine |
| SMILES | Fc1ccc([C@@H]2NCCS2)cc1 |
| InChI | InChI=1S/C9H10FNS/c10-8-3-1-7(2-4-8)9-11-5-6-12-9/h1-4,9,11H,5-6H2/t9-/m1/s1 |
| InChIKey | SPVFGDPOEAQORJ-SECBINFHSA-N |
| XLogP | 2.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |