C9H9BrFNS — CID 28775421
(2S)-2-(4-bromo-2-fluorophenyl)-1,3-thiazolidine (PubChem CID 28775421) has the molecular formula C9H9BrFNS and a molecular weight of 262.15 g/mol. Its IUPAC name is (2S)-2-(4-bromo-2-fluorophenyl)-1,3-thiazolidine.
| Compound Name | (2S)-2-(4-bromo-2-fluorophenyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 28775421 |
| Molecular Formula | C9H9BrFNS |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | (2S)-2-(4-bromo-2-fluorophenyl)-1,3-thiazolidine |
| SMILES | Fc1cc(Br)ccc1[C@H]1NCCS1 |
| InChI | InChI=1S/C9H9BrFNS/c10-6-1-2-7(8(11)5-6)9-12-3-4-13-9/h1-2,5,9,12H,3-4H2/t9-/m0/s1 |
| InChIKey | FDAOCLFUOJJQOV-VIFPVBQESA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |