C10H10F3NS — CID 129367454
(2R)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine (PubChem CID 129367454) has the molecular formula C10H10F3NS and a molecular weight of 233.26 g/mol. Its IUPAC name is (2R)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine.
| Compound Name | (2R)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 129367454 |
| Molecular Formula | C10H10F3NS |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | (2R)-2-[3-(trifluoromethyl)phenyl]-1,3-thiazolidine |
| SMILES | FC(F)(F)c1cccc([C@@H]2NCCS2)c1 |
| InChI | InChI=1S/C10H10F3NS/c11-10(12,13)8-3-1-2-7(6-8)9-14-4-5-15-9/h1-3,6,9,14H,4-5H2/t9-/m1/s1 |
| InChIKey | YCSCFSFFPPFZRY-SECBINFHSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |