C11H12F3NS — CID 66218013
2-[3-(trifluoromethyl)phenyl]-1,3-thiazinane (PubChem CID 66218013) has the molecular formula C11H12F3NS and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-[3-(trifluoromethyl)phenyl]-1,3-thiazinane.
| Compound Name | 2-[3-(trifluoromethyl)phenyl]-1,3-thiazinane |
|---|---|
| PubChem CID | 66218013 |
| Molecular Formula | C11H12F3NS |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 2-[3-(trifluoromethyl)phenyl]-1,3-thiazinane |
| SMILES | FC(F)(F)c1cccc(C2NCCCS2)c1 |
| InChI | InChI=1S/C11H12F3NS/c12-11(13,14)9-4-1-3-8(7-9)10-15-5-2-6-16-10/h1,3-4,7,10,15H,2,5-6H2 |
| InChIKey | LOJBJCPYGNYOQA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |