C11H13F2NS — CID 115525268
2-[4-(difluoromethyl)phenyl]-1,3-thiazinane (PubChem CID 115525268) has the molecular formula C11H13F2NS and a molecular weight of 229.30 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)phenyl]-1,3-thiazinane.
| Compound Name | 2-[4-(difluoromethyl)phenyl]-1,3-thiazinane |
|---|---|
| PubChem CID | 115525268 |
| Molecular Formula | C11H13F2NS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 2-[4-(difluoromethyl)phenyl]-1,3-thiazinane |
| SMILES | FC(F)c1ccc(C2NCCCS2)cc1 |
| InChI | InChI=1S/C11H13F2NS/c12-10(13)8-2-4-9(5-3-8)11-14-6-1-7-15-11/h2-5,10-11,14H,1,6-7H2 |
| InChIKey | MFGDMBMGQTYIDX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |