C11H12N2S — CID 66218756
4-(1,3-thiazinan-2-yl)benzonitrile (PubChem CID 66218756) has the molecular formula C11H12N2S and a molecular weight of 204.30 g/mol. Its IUPAC name is 4-(1,3-thiazinan-2-yl)benzonitrile.
| Compound Name | 4-(1,3-thiazinan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 66218756 |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.30 g/mol |
| Exact Mass | 204.07 |
| IUPAC Name | 4-(1,3-thiazinan-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2NCCCS2)cc1 |
| InChI | InChI=1S/C11H12N2S/c12-8-9-2-4-10(5-3-9)11-13-6-1-7-14-11/h2-5,11,13H,1,6-7H2 |
| InChIKey | STQGAOJNELWTTQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |