C11H13F2NOS — CID 66217767
2-[4-(difluoromethoxy)phenyl]-1,3-thiazinane (PubChem CID 66217767) has the molecular formula C11H13F2NOS and a molecular weight of 245.29 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-1,3-thiazinane.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-1,3-thiazinane |
|---|---|
| PubChem CID | 66217767 |
| Molecular Formula | C11H13F2NOS |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-1,3-thiazinane |
| SMILES | FC(F)Oc1ccc(C2NCCCS2)cc1 |
| InChI | InChI=1S/C11H13F2NOS/c12-11(13)15-9-4-2-8(3-5-9)10-14-6-1-7-16-10/h2-5,10-11,14H,1,6-7H2 |
| InChIKey | IJYMCUYOBKGJBE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |