C13H17F2NOS — CID 66226934
3-[4-(difluoromethoxy)phenyl]-7-methyl-1,4-thiazepane (PubChem CID 66226934) has the molecular formula C13H17F2NOS and a molecular weight of 273.35 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-7-methyl-1,4-thiazepane.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-7-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 66226934 |
| Molecular Formula | C13H17F2NOS |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-7-methyl-1,4-thiazepane |
| SMILES | CC1CCNC(c2ccc(OC(F)F)cc2)CS1 |
| InChI | InChI=1S/C13H17F2NOS/c1-9-6-7-16-12(8-18-9)10-2-4-11(5-3-10)17-13(14)15/h2-5,9,12-13,16H,6-8H2,1H3 |
| InChIKey | DGPNSBBNHMUEPJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |