C12H15ClFNS — CID 66226046
3-(3-chloro-4-fluorophenyl)-7-methyl-1,4-thiazepane (PubChem CID 66226046) has the molecular formula C12H15ClFNS and a molecular weight of 259.78 g/mol. Its IUPAC name is 3-(3-chloro-4-fluorophenyl)-7-methyl-1,4-thiazepane.
| Compound Name | 3-(3-chloro-4-fluorophenyl)-7-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 66226046 |
| Molecular Formula | C12H15ClFNS |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | 3-(3-chloro-4-fluorophenyl)-7-methyl-1,4-thiazepane |
| SMILES | CC1CCNC(c2ccc(F)c(Cl)c2)CS1 |
| InChI | InChI=1S/C12H15ClFNS/c1-8-4-5-15-12(7-16-8)9-2-3-11(14)10(13)6-9/h2-3,6,8,12,15H,4-5,7H2,1H3 |
| InChIKey | PPOORCVCNVUIMY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |