C12H16FNOS — CID 42544290
(2S)-2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine (PubChem CID 42544290) has the molecular formula C12H16FNOS and a molecular weight of 241.33 g/mol. Its IUPAC name is (2S)-2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine.
| Compound Name | (2S)-2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 42544290 |
| Molecular Formula | C12H16FNOS |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | (2S)-2-[4-(3-fluoropropoxy)phenyl]-1,3-thiazolidine |
| SMILES | FCCCOc1ccc([C@H]2NCCS2)cc1 |
| InChI | InChI=1S/C12H16FNOS/c13-6-1-8-15-11-4-2-10(3-5-11)12-14-7-9-16-12/h2-5,12,14H,1,6-9H2/t12-/m0/s1 |
| InChIKey | YJMNOVGUJOGKGS-LBPRGKRZSA-N |
| XLogP | 2.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|