About 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride
4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride (PubChem CID 170986640) has the molecular formula C10H11ClN2S
and a molecular weight of 226.73 g/mol. Its IUPAC name is 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride.
Molecular Properties
| Compound Name | 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride |
| PubChem CID | 170986640 |
| Molecular Formula | C10H11ClN2S |
| Molecular Weight | 226.73 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1ccc(C2NCCS2)cc1 |
| InChI | InChI=1S/C10H10N2S.ClH/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10;/h1-4,10,12H,5-6H2;1H |
| InChIKey | IPYBEALDKPXTEB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride?
The IUPAC name of 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride (CID 170986640) is 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride.
What is the SMILES notation for 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride?
The canonical SMILES for 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride is Cl.N#Cc1ccc(C2NCCS2)cc1.
What is the InChIKey of 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride?
The InChIKey is IPYBEALDKPXTEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2S.ClH/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10;/h1-4,10,12H,5-6H2;1H.
What are the key properties of 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride?
4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride has a molecular weight of 226.73 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-thiazolidin-2-yl)benzonitrile;hydrochloride is sourced from PubChem (CID 170986640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).