C12H9N — CID 101062638
4-cyclopenta-2,4-dien-1-ylbenzonitrile (PubChem CID 101062638) has the molecular formula C12H9N and a molecular weight of 167.21 g/mol. Its IUPAC name is 4-cyclopenta-2,4-dien-1-ylbenzonitrile.
| Compound Name | 4-cyclopenta-2,4-dien-1-ylbenzonitrile |
|---|---|
| PubChem CID | 101062638 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 4-cyclopenta-2,4-dien-1-ylbenzonitrile |
| SMILES | N#Cc1ccc(C2C=CC=C2)cc1 |
| InChI | InChI=1S/C12H9N/c13-9-10-5-7-12(8-6-10)11-3-1-2-4-11/h1-8,11H |
| InChIKey | OVFPDOBIAUVQNY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |